A5567612
3-(4-Methoxybenzoyl)propionic acid , >98.0%(HPLC) , 3153-44-4
CAS NO.:3153-44-4
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00002795
EINECS: 221-593-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB92.80 | In Stock |
|
| 10g | RMB172.00 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100G | RMB1213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 307.4°C (rough estimate) |
| Density | 1.2252 (rough estimate) |
| refractive index | 1.5020 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.58±0.17(Predicted) |
| color | White to Orange to Green |
| Water Solubility | 18g/L at 25℃ |
| BRN | 785074 |
| InChI | InChI=1S/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14) |
| InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N |
| SMILES | C1(C=CC(OC)=CC=1)C(=O)CCC(=O)O |
| LogP | 1.38 |
| CAS DataBase Reference | 3153-44-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |



![4-[3,4-(Ethylenedioxy)phenyl]-4-oxobutyric acid](https://img.chemicalbook.com/CAS/GIF/54557-81-2.gif)


