A5569612
2-Methylthio-4-pyrimidinol , ≥98% , 5751-20-2
CAS NO.:5751-20-2
Empirical Formula: C5H6N2OS
Molecular Weight: 142.18
MDL number: MFCD00955672
EINECS: 227-274-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100g | RMB5599.20 | In Stock |
|
| 500g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200.0 to 204.0 °C |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.80±0.40(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C5H6N2OS/c1-9-5-6-3-2-4(8)7-5/h2-3H,1H3,(H,6,7,8) |
| InChIKey | UYHSQVMHSFXUOA-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=CC(=O)N1 |
| CAS DataBase Reference | 5751-20-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4(1H)-Pyrimidinone, 2-(methylthio)-(5751-20-2) |
Description and Uses
A competitive inhibitor of Nitric Oxide Synthase (NOS).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H335-H315-H318-H302 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| HS Code | 29335990 |




![1-[1-(4-Fluorobenzyl)-1H-Benzimidazole-2yl]-N-methyl-4-piperidineamine](https://img.chemicalbook.com/CAS/20150408/GIF/108635-83-2.gif)


