A5574912
2-(Methylphenylamino)ethanol , >97.0%(T) , 93-90-3
CAS NO.:93-90-3
Empirical Formula: C9H13NO
Molecular Weight: 151.21
MDL number: MFCD00020572
EINECS: 202-285-9
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB67.20 | In Stock |
|
| 100ML | RMB156.80 | In Stock |
|
| 500ML | RMB431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77 °C |
| Boiling point: | 229 °C (lit.) |
| Density | 1.06 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 14.79±0.10(Predicted) |
| Specific Gravity | 1.071.060 |
| color | Light yellow to Brown |
| InChI | InChI=1S/C9H13NO/c1-10(7-8-11)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3 |
| InChIKey | VIIZJXNVVJKISZ-UHFFFAOYSA-N |
| SMILES | C(O)CN(C)C1=CC=CC=C1 |
| CAS DataBase Reference | 93-90-3(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(2-Hydroxyethyl)-N-methylaniline(93-90-3) |
| EPA Substance Registry System | Ethanol, 2-(methylphenylamino)- (93-90-3) |
Description and Uses
Octaacetyl-β-maltose is used to prepare self-reproducing micelles in the preparation of triazole-containing disaccharides. It has also been used as a reactant in the synthesis of neoglycoconjugates through glycosyl aldehydes featuring bioorthogonal oxime bond formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | KL7175000 |
| TSCA | TSCA listed |
| HS Code | 29221990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





