A5575212
Methyl 4-Methylsalicylate , ≥98.0%(GC) , 4670-56-8
CAS NO.:4670-56-8
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00020130
EINECS: 225-117-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB92.80 | In Stock |
|
| 25G | RMB330.40 | In Stock |
|
| 100g | RMB817.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-28℃ |
| Boiling point: | 242 °C |
| Density | 1.147 |
| refractive index | 1.5370 |
| Flash point: | 28 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Low Melting Solid |
| pka | 9.87±0.10(Predicted) |
| color | Pale brown to pale yellow |
| FreezingPoint | 24.0 to 28.0 ℃ |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C9H10O3/c1-6-3-4-7(8(10)5-6)9(11)12-2/h3-5,10H,1-2H3 |
| InChIKey | UITFCFWKYAOJEJ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C)C=C1O |
| LogP | 3.000 (est) |
| CAS DataBase Reference | 4670-56-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2918230000 |





