Methyl arachidonate , ≥90%(GC) , 2566-89-4
Synonym(s):
Arachidonic acid methyl ester
CAS NO.:2566-89-4
Empirical Formula: C21H34O2
Molecular Weight: 318.49
MDL number: MFCD00016775
EINECS: 219-900-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB159.20 | In Stock |
|
| 250MG | RMB559.20 | In Stock |
|
| 1g | RMB1567.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 200-205℃ (1-2 Torr) |
| Density | 0.9168 g/cm3 |
| refractive index | 1.4875 (589.3 nm 20℃) |
| storage temp. | 2-8°C |
| solubility | chloroform: 50 mg/mL, clear, colorless |
| form | Liquid |
| color | Colourless |
| biological source | Mortierella alpina |
| BRN | 1714445 |
| Stability: | Light Sensitive |
| InChI | 1S/C21H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-20H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | OFIDNKMQBYGNIW-ZKWNWVNESA-N |
| SMILES | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)OC |
| LogP | 7.466 (est) |
Description and Uses
Arachidonic acid is the keystone essential fatty acid at the origin of the arachidonic acid cascade. It is converted by cyclooxygenase, lipoxygenase, and epoxygenase enzymes into more than one hundred fifty different potent primary autacoid metabolites in species ranging from fungi to plants to mammals. Arachidonic acid is stored in tissue phospholipids in esterified form, where it comprises a small but critically controlled percentage of the polyunsaturated fatty acid pool. Arachidonic acid content is frequently measured by the saponification of the lipid fraction followed by methyl esterification and gas chromatographic analysis of the resulting FAME (fatty acid methyl ester) compounds. Arachidonic acid methyl ester can also be incorporated into dietary regimens or fed to cultured cells as a source of exogenous arachidonate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H304-H315-H336-H410 |
| Precautionary statements | P261-P273-P301+P310-P331-P501 |
| PPE | Eyeshields, Faceshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | F,Xn,N |
| Risk Statements | 19-67-65-50/53-38-11 |
| Safety Statements | 9-16-29-33-60-61-62 |
| RIDADR | UN 3183 4.2/PG 3 |
| WGK Germany | 3 |
| F | 10-21-23 |
| HazardClass | 4.2 |
| PackingGroup | I |
| Storage Class | 10 - Combustible liquids |








