A5589012
Methyl 3-Hydroxy-2-naphthoate , >98.0%(GC) , 883-99-8
CAS NO.：883-99-8
Empirical Formula: C12H10O3
Molecular Weight: 202.21
MDL number: MFCD00004099
EINECS: 212-936-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100g | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-75 °C (lit.) |
| Boiling point: | 205-207 °C (lit.) |
| Density | 1.1868 (rough estimate) |
| refractive index | 1.5440 (estimate) |
| Flash point: | 205-207°C/160mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 9.36±0.40(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 1074526 |
| InChI | InChI=1S/C12H10O3/c1-15-12(14)10-6-8-4-2-3-5-9(8)7-11(10)13/h2-7,13H,1H3 |
| InChIKey | YVVBECLPRBAATK-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(O)=C1C(OC)=O |
| CAS DataBase Reference | 883-99-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 3-hydroxy-, methyl ester (883-99-8) |
Description and Uses
Methyl 3-hydroxy-2-naphthoate undergoes asymmetric oxidative coupling using mono-N-alkylated octahydrobinaphthyl-2,2′-diamine chiral ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| F | 9-23 |
| TSCA | TSCA listed |
| HS Code | 2918.29.7500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
