A5593612
<i>meso</i>-Hydrobenzoin , >98.0% , 579-43-1
Synonym(s):
meso-1,2-Diphenyl-1,2-ethanediol;meso-1,2-Diphenyl-1,2-ethanediol;meso-Hydrobenzoin, meso-1,2-Diphenylethylene glycol
CAS NO.:579-43-1
Empirical Formula: C14H14O2
Molecular Weight: 214.26
MDL number: MFCD00064253
EINECS: 207-758-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB112.80 | In Stock |
|
| 5G | RMB378.40 | In Stock |
|
| 25G | RMB1322.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-139 °C(lit.) |
| Boiling point: | 373.0±37.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in hot alcohol or chloroform. |
| pka | 13.38±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| Merck | 14,4777 |
| BRN | 2050814 |
| InChI | 1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
| InChIKey | IHPDTPWNFBQHEB-OKILXGFUSA-N |
| SMILES | O[C@H]([C@H](O)c1ccccc1)c2ccccc2 |
| LogP | 1.910 |
| CAS DataBase Reference | 579-43-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Meso-hydrobenzoin(579-43-1) |
Description and Uses
meso- Hydrobenzoin has been used in the preparation of trans-methyl meso- hydrobenzoin phosphite.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29062900 |
| Storage Class | 11 - Combustible Solids |






