A5598912
6-Methoxyisatin , >97.0%(HPLC)(T) , 52351-75-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB99.20 | In Stock |
|
| 5G | RMB282.40 | In Stock |
|
| 25g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-230 °C(Solv: water (7732-18-5)) |
| Density | 1.346±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 9.50±0.20(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H7NO3/c1-13-5-2-3-6-7(4-5)10-9(12)8(6)11/h2-4H,1H3,(H,10,11,12) |
| InChIKey | MOJHIZLOKWRPIS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(OC)=C2)C(=O)C1=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






