A5611312
4-Methoxy-1-naphthol , >98.0%(GC) , 84-85-5
Synonym(s):
1-Hydroxy-4-methoxynaphthalene
CAS NO.：84-85-5
Empirical Formula: C11H10O2
Molecular Weight: 174.2
MDL number: MFCD00003976
EINECS: 201-566-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB82.40 | In Stock |
|
| 5G | RMB285.60 | In Stock |
|
| 25G | RMB1207.20 | In Stock |
|
| 100g | RMB4551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C (lit.) |
| Boiling point: | 265.17°C (rough estimate) |
| Density | 1.0844 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.24±0.40(Predicted) |
| color | Pale Purple to Light Purple |
| Water Solubility | Soluble in water. |
| BRN | 1818465 |
| InChI | InChI=1S/C11H10O2/c1-13-11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7,12H,1H3 |
| InChIKey | BOTGCZBEERTTDQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=C(OC)C=C1 |
| CAS DataBase Reference | 84-85-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenol, 4-methoxy- (84-85-5) |
Description and Uses
4-Methoxy-1-naphthol was used in the synthesis of 3-(4-hydroxy-1-naphthoxy)lactic acid (4-HO-NLA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29095000 |
