A5622412
Monomethyl Isophthalate , >98.0% , 1877-71-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 10g | RMB122.40 | In Stock |
|
| 25g | RMB248.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-196 °C (lit.) |
| Boiling point: | 339.3±25.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Crystalline Powder |
| pka | 3.83±0.10(Predicted) |
| color | White to off-white |
| BRN | 2048750 |
| InChI | InChI=1S/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| InChIKey | WMZNGTSLFSJHMZ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 1877-71-0(CAS DataBase Reference) |
Description and Uses
Exploited in the synthesis of polymer films.1
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 13 - Non Combustible Solids |






