PRODUCT Properties
| Melting point: | 35°C | 
                                    
| Boiling point: | 82 °C(Press: 0.2 Torr) | 
                                    
| Density | 0.9839 g/cm3 | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| form | powder to lump | 
                                    
| pka | 3.84±0.11(Predicted) | 
                                    
| color | White to Orange to Green | 
                                    
| InChI | InChI=1S/C9H14O4/c1-3-4-5-13-9(12)7(2)6-8(10)11/h2-6H2,1H3,(H,10,11) | 
                                    
| InChIKey | VVAAYFMMXYRORI-UHFFFAOYSA-N | 
                                    
| SMILES | C(OCCCC)(=O)C(=C)CC(O)=O | 
                                    
| CAS DataBase Reference | 6439-57-2 | 
                                    
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| HS Code | 2917.19.7050 | 






