A5634012
4-Methylcyclohexanecarboxylic Acid (<i>cis</i>- and <i>trans</i>- mixture) , >98.0% , 4331-54-8
CAS NO.：4331-54-8
Empirical Formula: C8H14O2
Molecular Weight: 142.2
MDL number: MFCD00074909
EINECS: 224-369-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| 25G | RMB1007.20 | In Stock |
|
| 100G | RMB4013.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110 °C |
| Boiling point: | 134-136 °C/15 mmHg (lit.) |
| Density | 1.005 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO, Methanol |
| pka | 4.92±0.10(Predicted) |
| form | Oil |
| color | Clear Colorless |
| InChI | InChI=1S/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | QTDXSEZXAPHVBI-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(C)CC1 |
Description and Uses
4-Methyl-1-cyclohexanecarboxylic acid was used to investigate the palladium core-porous silica shell-nanoparticles catalyzed hydrogenation of 4-carboxybenzaldehyde (4-CBA) to p-toluic acid. It was also used in the synthesis of substituted cyclohexyl carbonyl chlorides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| HS Code | 29162090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
