A5641312
Methyl 2-Pyrazinecarboxylate , >97.0%(GC) , 6164-79-0
CAS NO.:6164-79-0
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00014611
EINECS: 228-198-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB291.20 | In Stock |
|
| 100G | RMB943.20 | In Stock |
|
| 500g | RMB3136.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-61 °C(lit.) |
| Boiling point: | 104°C/7mmHg(lit.) |
| Density | 1.213±0.06 g/cm3(Predicted) |
| Flash point: | >100°(212°F) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -0.91±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless |
| Merck | 14,7959 |
| BRN | 118345 |
| InChI | InChI=1S/C6H6N2O2/c1-10-6(9)5-4-7-2-3-8-5/h2-4H,1H3 |
| InChIKey | TWIIRMSFZNYMQE-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=CN=C1 |
| LogP | -0.230 |
| CAS DataBase Reference | 6164-79-0(CAS DataBase Reference) |
| EPA Substance Registry System | Pyrazinecarboxylic acid, methyl ester (6164-79-0) |
Description and Uses
METHYL PYRAZINE-2-CARBOXYLATE is used as an intermediate for the synthesis of MOF material ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






