A6782012
2,3-Pyrazinedicarboxylic anhydride , 97% , 4744-50-7
Synonym(s):
Furo[3,4-b]pyrazine-5,7-dione
CAS NO.：4744-50-7
Empirical Formula: C6H2N2O3
Molecular Weight: 150.09
MDL number: MFCD00179418
EINECS: 225-260-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB104.00 | In Stock |
|
| 100G | RMB338.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.)(lit.) |
| Boiling point: | 357.3±22.0 °C(Predicted) |
| Density | 1.686±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Actonitrile (Slightly), DMSO |
| form | Solid |
| pka | -3.43±0.20(Predicted) |
| color | White to light brown crystalline powder |
| InChI | InChI=1S/C6H2N2O3/c9-5-3-4(6(10)11-5)8-2-1-7-3/h1-2H |
| InChIKey | AWJWCTOOIBYHON-UHFFFAOYSA-N |
| SMILES | C12C(=O)OC(=O)C1=NC=CN=2 |
| LogP | -0.900 (est) |
| CAS DataBase Reference | 4744-50-7(CAS DataBase Reference) |
Description and Uses
2,?3-?Pyrazinedicarboxylic Anhydride is a reagent used in the synthesis of highly potent and selective abietane type diterpenoid amides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
