A5673512
Methyl 4-(Bromomethyl)-3-methoxybenzoate , >97.0% , 70264-94-7
CAS NO.:70264-94-7
Empirical Formula: C10H11BrO3
Molecular Weight: 259.1
MDL number: MFCD00270115
EINECS: 410-310-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.16 | In Stock |
|
| 5G | RMB170.64 | In Stock |
|
| 10g | RMB238.24 | In Stock |
|
| 25G | RMB539.20 | In Stock |
|
| 100g | RMB5119.20 | In Stock |
|
| 500g | RMB17599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94°C |
| Boiling point: | 324.2±32.0 °C(Predicted) |
| Density | 1.432 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-5-7(10(12)14-2)3-4-8(9)6-11/h3-5H,6H2,1-2H3 |
| InChIKey | UXSNXOMMJXTFEG-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(CBr)C(OC)=C1 |
| CAS DataBase Reference | 70264-94-7(CAS DataBase Reference) |
Description and Uses
Methyl 4-(Bromomethyl)-3-methoxybenzoate is an intermediate used to prepare heteroarylphenyloxoacetyl and heteroarylphenylsulfonyl benzoylpiperazine analogs of BMS 378806 as HIV entry inhibitors. It is also used to synthesize steroid 5α-reductase inhibiting acylpiperidines.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H317-H318-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53-43-41-38 |
| Safety Statements | 26-36/37/39-61-60 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2918999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |








