A5674512
3'-Methoxyphenacyl Bromide , >98.0% , 5000-65-7
Synonym(s):
3′-Methoxyphenacyl bromide
CAS NO.:5000-65-7
Empirical Formula: C9H9BrO2
Molecular Weight: 229.07
MDL number: MFCD00000199
EINECS: 225-666-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB141.60 | In Stock |
|
| 25G | RMB428.00 | In Stock |
|
| 100G | RMB1160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C(lit.) |
| Boiling point: | 215.8°C (rough estimate) |
| Density | 1.4921 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | White to slightly yellow-green |
| BRN | 510128 |
| InChI | InChI=1S/C9H9BrO2/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | IOOHBIFQNQQUFI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(OC)=C1)CBr |
| CAS DataBase Reference | 5000-65-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-3'-methoxyacetophenone(5000-65-7) |
Description and Uses
2-bromo-3′-methoxyacetophenone, an alkylating agent, has been used to stabilize clopidogrel active metabolite (AM) in human plasma. It has also been used in the derivatisation of active metabolites in blood to ensure its stability during sample processing and storage.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36/37-22 |
| Safety Statements | 26-27-28-36/37/39-45-34 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |






