A5675212
Methyl 2,6-Dichloronicotinate , >98.0%(GC) , 65515-28-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1G | RMB70.40 | In Stock |
|
| 5G | RMB218.40 | In Stock |
|
| 25g | RMB763.20 | In Stock |
|
| 100g | RMB2110.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60 °C(lit.) |
| Boiling point: | 270.5±35.0 °C(Predicted) |
| Density | 1.426±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.55±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Air Sensitive |
| λmax | 276nm(lit.) |
| InChI | InChI=1S/C7H5Cl2NO2/c1-12-7(11)4-2-3-5(8)10-6(4)9/h2-3H,1H3 |
| InChIKey | IFVVGOJYWCHRCT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(OC)=O |
Description and Uses
Replacement of chlorides with fluorides using anhydrous nucleophilic fluoride salts generated from potassium fluoride and an arene transfer agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
