BD0607453
Di-n-octylsebacate , 98% , 2432-87-3
CAS NO.:2432-87-3
Empirical Formula: C26H50O4
Molecular Weight: 426.67
MDL number: MFCD00059269
EINECS: 219-411-3
| Pack Size | Price | Stock | Quantity |
| 100g | RMB149.60 | In Stock |
|
| 500g | RMB430.40 | In Stock |
|
| 1000g | RMB710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 18°C |
| Boiling point: | 256℃ |
| Density | 0.912 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.451 |
| Flash point: | 210℃ |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Water Solubility | 3.856ng/L at 25℃ |
| FreezingPoint | -48℃ |
| Dielectric constant | 4.0(27℃) |
| InChI | InChI=1S/C26H50O4/c1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2/h3-24H2,1-2H3 |
| InChIKey | MIMDHDXOBDPUQW-UHFFFAOYSA-N |
| SMILES | C(OCCCCCCCC)(=O)CCCCCCCCC(OCCCCCCCC)=O |
| LogP | 10.23 at 25℃ |
| CAS DataBase Reference | 2432-87-3(CAS DataBase Reference) |
| EPA Substance Registry System | Decanedioic acid, dioctyl ester (2432-87-3) |
Description and Uses
Dioctyl sebacate is used as a plasticizer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |





