A5684612
2-Methoxy-5-nitropyridine , >99.0%(GC) , 5446-92-4
CAS NO.:5446-92-4
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00006263
EINECS: 226-661-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB64.00 | In Stock |
|
| 25G | RMB182.40 | In Stock |
|
| 100g | RMB419.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-108 °C(lit.) |
| Boiling point: | 277.46°C (rough estimate) |
| Density | 0.45 |
| refractive index | 1.5100 (estimate) |
| Flash point: | 130 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | -0+-.0.10(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| BRN | 126991 |
| InChI | InChI=1S/C6H6N2O3/c1-11-6-3-2-5(4-7-6)8(9)10/h2-4H,1H3 |
| InChIKey | WUPLOZFIOAEYMG-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 5446-92-4(CAS DataBase Reference) |
Description and Uses
2-Methoxy-5-nitropyridine is used in the synthesis of pyrrolopyridones as a potential protein tyrosine kinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






