A5685112
Methyl 4-Bromobutyrate , >98.0%(GC) , 4897-84-1
CAS NO.：4897-84-1
Empirical Formula: C5H9BrO2
Molecular Weight: 181.03
MDL number: MFCD00041482
EINECS: 225-523-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10G | RMB42.40 | In Stock |
|
| 50G | RMB151.20 | In Stock |
|
| 100G | RMB286.40 | In Stock |
|
| 250G | RMB639.20 | In Stock |
|
| 500g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-190 °C |
| Boiling point: | 186-187 °C |
| Density | 1.434 |
| refractive index | 1.4620 |
| Flash point: | 186-187°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.434 |
| color | Clear colorless to pale yellow |
| Water Solubility | insoluble |
| BRN | 1745618 |
| InChI | InChI=1S/C5H9BrO2/c1-8-5(7)3-2-4-6/h2-4H2,1H3 |
| InChIKey | QAWFLJGZSZIZHO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCBr |
| CAS DataBase Reference | 4897-84-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 4-bromobutyrate(4897-84-1) |
Description and Uses
Br-C3-methyl ester is a Alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTAC PD-1/PD-L1 degrader-1 (HY-131183)[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-24/25 |
| HS Code | 29156000 |
