A5708712
[2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl) , ≥97% , 3637-26-1
Synonym(s):
N-(3-Sulfopropyl)-N-(methacryloxyethyl)-N,N-dimethylammonium betaine;2-(N-3-Sulfopropyl-N,N-dimethyl ammonium)ethyl methacrylate;DMAPS;N-(3-Sulfopropyl)-N-methacroyloxyethyl- N,N-dimethylammonium betaine;SPE
CAS NO.:3637-26-1
Empirical Formula: C11H21NO5S
Molecular Weight: 279.35
MDL number: MFCD00040574
EINECS: 222-860-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB106.40 | In Stock |
|
| 50G | RMB208.80 | In Stock |
|
| 100g | RMB317.60 | In Stock |
|
| 250G | RMB779.20 | In Stock |
|
| 500g | RMB1177.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155 °C(lit.) |
| bulk density | 400kg/m3 |
| Density | 1.293-1.303g/cm3 at 22℃ |
| Flash point: | >110°C |
| storage temp. | Store below +30°C. |
| solubility | 500g/l |
| form | Powder |
| color | White to Almost white |
| PH | 6.3 (100g/l, H2O, 20℃) |
| Water Solubility | 500g/L |
| InChI | InChI=1S/C11H21NO5S/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16/h1,5-9H2,2-4H3 |
| InChIKey | BCAIDFOKQCVACE-UHFFFAOYSA-N |
| SMILES | [N+](C)(C)(CCOC(=O)C(=C)C)CCCS([O-])(=O)=O |
| LogP | -4.23 |
Description and Uses
Due to its hygroscopic nature, [2-(methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide (DMAPS) can contain up to one molecule of water per monomer unit. This material should be stored in a cool, dry place and depending on the reaction conditions, water may need to be removed prior to polymerization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H302 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 21/22 |
| Safety Statements | 37/39 |
| WGK Germany | 3 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |

![[2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)](https://img.chemicalbook.com/CAS/GIF/3637-26-1.gif)




