A5716912
2-<WBR>Methyl-<WBR>2-<WBR>cyclopenten-<WBR>1-<WBR>one , 97% , 1120-73-6
CAS NO.:1120-73-6
Empirical Formula: C6H8O
Molecular Weight: 96.13
MDL number: MFCD00012275
EINECS: 627-283-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB208.80 | In Stock |
|
| 5G | RMB911.20 | In Stock |
|
| 25g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158-161 °C(lit.) |
| Density | 0.979 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 120 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear yellow |
| InChI | InChI=1S/C6H8O/c1-5-3-2-4-6(5)7/h3H,2,4H2,1H3 |
| InChIKey | ZSBWUNDRDHVNJL-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC=C1C |
| LogP | 0.301 (est) |
| CAS DataBase Reference | 1120-73-6 |
Description and Uses
2-Methyl-2-cyclopentenone is used in preparation for molecular characterization of the pyrolysis of biomass.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 16-27-36/37/39 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29142990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |





