A5751912
Methyl 1<I>H</I>-<WBR>pyrrole-<WBR>3-<WBR>carboxylate , 97% , 2703-17-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB61.60 | In Stock |
|
| 5g | RMB229.60 | In Stock |
|
| 10g | RMB431.20 | In Stock |
|
| 25g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-89 °C |
| Boiling point: | 284℃ |
| Density | 1.184 |
| Flash point: | 126℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 15.42±0.50(Predicted) |
| form | solid |
| color | Off-white to light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H7NO2/c1-9-6(8)5-2-3-7-4-5/h2-4,7H,1H3 |
| InChIKey | WLBNVSIQCFHAQB-UHFFFAOYSA-N |
| SMILES | N1C=CC(C(OC)=O)=C1 |
Description and Uses
Methyl pyrrole-3-carboxylate is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37-60 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







