A5756412
4-<WBR>Methylpyridine-<WBR>3-<WBR>carboxylic acid , 97% , 3222-50-2
Synonym(s):
4-Methylnicotinic acid
CAS NO.：3222-50-2
Empirical Formula: C7H7NO2
Molecular Weight: 137.14
MDL number: MFCD00128869
EINECS: 625-824-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5g | RMB152.00 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-221 °C |
| Boiling point: | 304.1±22.0 °C(Predicted) |
| Density | 1.230±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 1.67±0.25(Predicted) |
| color | White to tan |
| InChI | InChI=1S/C7H7NO2/c1-5-2-3-8-4-6(5)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey | ZKUZSTXNVMIDCY-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1C(O)=O |
| CAS DataBase Reference | 3222-50-2(CAS DataBase Reference) |
Description and Uses
4-Methylnicotinic Acid is used in the synthesis of nicotinic acid substituted nicotinic acid adenine dinucleotide phosphate analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
