A5759412
3-<WBR>(4-<WBR>Morpholinomethyl)<WBR>phenylboronic acid pinacol ester , 95% , 364794-80-9
Synonym(s):
3-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaboran-2-yl)benzyl]morpholine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB260.00 | In Stock |
|
| 5g | RMB835.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47 °C |
| Flash point: | 110 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| color | Off white |
| InChI | 1S/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)15-7-5-6-14(12-15)13-19-8-10-20-11-9-19/h5-7,12H,8-11,13H2,1-4H3 |
| InChIKey | RCGRLLZELIIKDH-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2cccc(CN3CCOCC3)c2 |
Description and Uses
3-(4-Morpholinomethyl)phenylboronic acid pinacol ester can be used as a reactant:
- In the palladium-catalyzed Suzuki-Miyaura coupling reaction to synthesize biaryl derivatives.
- To prepare a morpholinylphenyl anilinoquinazoline lapatinib analog.
- To synthesize diaryl or heteroaryl triazole quinuclidine derivatives as potent α7 nicotinic acetylcholine receptor ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |






