A5772112
4-<WBR>(Methylsulfonyl)<WBR>benzyl bromide , 97% , 53606-06-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1G | RMB92.80 | In Stock |
|
| 5g | RMB220.80 | In Stock |
|
| 25g | RMB724.00 | In Stock |
|
| 100g | RMB2887.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-86 °C |
| Boiling point: | 375.2±34.0 °C(Predicted) |
| Density | 1.550 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Beige to brown |
| InChI | 1S/C8H9BrO2S/c1-12(10,11)8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | HGKPAXHJTMHWAH-UHFFFAOYSA-N |
| SMILES | CS(C1=CC=C(CBr)C=C1)(=O)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22-34 |
| Safety Statements | 37/39-26-45-36/37/39 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




