A5918012
Methyl 3-amino-6-iodopyrazine-2-carboxylate , 95% , 1458-16-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB157.68 | In Stock |
|
| 1G | RMB379.44 | In Stock |
|
| 5G | RMB1426.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-202℃ |
| Boiling point: | 387.9±42.0 °C(Predicted) |
| Density | 2.020±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C, protect from light |
| form | Solid |
| pka | -1.59±0.10(Predicted) |
| Appearance | Yellow to brown Solid |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H6IN3O2/c1-12-6(11)4-5(8)9-2-3(7)10-4/h2H,1H3,(H2,8,9) |
| InChIKey | FDLARAKNPMCCKJ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(I)=CN=C1N |
Description and Uses
Methyl 3-amino-6-iodopyrazine-2-carboxylate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
