A6060312
Methyl 4-(hydroxymethyl)picolinate , 95% , 317335-15-2
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB135.20 | In Stock |
|
| 100mg | RMB200.80 | In Stock |
|
| 250MG | RMB359.20 | In Stock |
|
| 1g | RMB959.20 | In Stock |
|
| 5g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76℃ |
| Boiling point: | 335.8±32.0 °C(Predicted) |
| Density | 1.244±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 13.17±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H9NO3/c1-12-8(11)7-4-6(5-10)2-3-9-7/h2-4,10H,5H2,1H3 |
| InChIKey | WEIFQBALQLWZFZ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=CC(CO)=C1 |
Description and Uses
Methyl 4-(hydroxymethyl)pyridine-2 is used as an intermediate in pharmaceuticals and also finds use in chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933399990 |






![7,9-DIMETHOXYCARBONYL-2-ETHOXYCARBONYL-5-METHOXY-1H-PYRROLO-[2,3-F]QUINOLINE](https://img.chemicalbook.com/StructureFile/ChemBookStructure22/GIF/CB1648887.gif)
