BD2836845
Diethylpyridine-2,4-dicarboxylate , 97% , 41438-38-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB266.40 | In Stock |
|
| 1g | RMB668.00 | In Stock |
|
| 5g | RMB2359.20 | In Stock |
|
| 25g | RMB5526.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31 °C |
| Boiling point: | 330.9±22.0 °C(Predicted) |
| Density | 1.165±0.06 g/cm3(Predicted) |
| vapor pressure | 0.022Pa at 25℃ |
| storage temp. | 2-8°C |
| solubility | ≤50mg/ml in ethanol;20mg/ml in DMSO;30mg/ml in dimethyl formamide |
| pka | -0.69±0.10(Predicted) |
| form | Crystalline |
| color | White to Almost white |
| InChI | InChI=1S/C11H13NO4/c1-3-15-10(13)8-5-6-12-9(7-8)11(14)16-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | MUUDQLHCIAOWPR-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)=NC=CC(C(OCC)=O)=C1 |
| LogP | 1.92 at 20℃ and pH7.82 |
| Surface tension | 56.3mN/m at 1g/L and 19.7℃ |
| CAS DataBase Reference | 41438-38-4 |
Description and Uses
Diethyl pyridine-2,4-dicarb is a potent prolyl 4-hydroxylase-directed proinhibitor. Diethyl pyridine-2,4-dicarb inhibits prolyl hydroxylation and procollagen processing in chick-embryo calvaria[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933.39.9200 |
