A6075012
5-Methyl-1,3,4-oxadiazol-2-amine , 98% , 52838-39-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB37.60 | In Stock |
|
| 1G | RMB92.00 | In Stock |
|
| 5g | RMB264.80 | In Stock |
|
| 25g | RMB1104.80 | In Stock |
|
| 100g | RMB3427.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-186°C |
| Boiling point: | 228.8±23.0 °C(Predicted) |
| Density | 1.283±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | -0.42±0.13(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C3H5N3O/c1-2-5-6-3(4)7-2/h1H3,(H2,4,6) |
| InChIKey | XPXWYVCQCNFIIJ-UHFFFAOYSA-N |
| SMILES | O1C(C)=NN=C1N |
| CAS DataBase Reference | 52838-39-8(CAS DataBase Reference) |
Description and Uses
5-Methyl-1,3,4-oxadiazol-2-amine is used to study structure-activity relationships of endonuclease 1 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2922390090 |
