BD7692731
5-Phenyl-1,3,4-oxadiazol-2-amine , 98% , 1612-76-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB85.60 | In Stock |
|
| 5g | RMB299.20 | In Stock |
|
| 10g | RMB577.60 | In Stock |
|
| 25g | RMB1179.20 | In Stock |
|
| 100g | RMB3536.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-242°C |
| Boiling point: | 332.3±25.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -1.15±0.13(Predicted) |
| color | White to Light yellow |
| λmax | 277nm(EtOH)(lit.) |
| InChI | InChI=1S/C8H7N3O/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) |
| InChIKey | CQSFYCBGVMWPCM-UHFFFAOYSA-N |
| SMILES | O1C(C2=CC=CC=C2)=NN=C1N |
| CAS DataBase Reference | 1612-76-6(CAS DataBase Reference) |
Description and Uses
5-Phenyl-1,3,4-oxadiazol-2-amine can be used as a pH indicator in the acidic range in living cells due to the fluorescence the compound gives off when in an acidic environment.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | RO0620000 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





