A6103612
2-Methoxy-3-methyl-5-nitropyridine , 98% , 89694-10-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB52.00 | In Stock |
|
| 5g | RMB183.20 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 279.7±35.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -0.34±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C7H8N2O3/c1-5-3-6(9(10)11)4-8-7(5)12-2/h3-4H,1-2H3 |
| InChIKey | HEDKXDCXKNQWEX-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 89694-10-0(CAS DataBase Reference) |
Description and Uses
2-Methoxy-3-methyl-5-nitropyridine is used in the preparation of heteroaromatic cyanoindoline derivative for use as NIK inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| HS Code | 2933399990 |
