A6146612
2-Naphthaleneacetic acid , 99% , 581-96-4
Synonym(s):
2-Naphthylacetic acid
CAS NO.：581-96-4
Empirical Formula: C12H10O2
Molecular Weight: 186.21
MDL number: MFCD00004126
EINECS: 209-475-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB498.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143 °C (lit.) |
| Boiling point: | 280.69°C (rough estimate) |
| Density | 1.1032 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: 50 mg/mL, clear |
| pka | pK1:4.256 (25°C) |
| form | Crystalline Powder or Flakes |
| color | White to almost white |
| Water Solubility | insoluble |
| BRN | 973396 |
| InChI | InChI=1S/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14) |
| InChIKey | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CC(O)=O |
| CAS DataBase Reference | 581-96-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthaleneacetic acid(581-96-4) |
Description and Uses
2-Naphthylacetic acid can be used to synthesize hydrolase inhibitors. It can also be utilized for developing?γ-dipeptide derivatives that can bind human somatostatin receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | QJ0876000 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
