A6148112
cis-5-Norbornene-endo-2,3-dicarboxylic anhydride , 95% , 129-64-6
Synonym(s):
cis-endo-5-Norbornene-2,3-dicarboxylic anhydride;cis-endo-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride
CAS NO.:129-64-6
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00151106
EINECS: 204-957-7
| Pack Size | Price | Stock | Quantity |
| 100G | RMB27.20 | In Stock |
|
| 500G | RMB103.20 | In Stock |
|
| 2.5KG | RMB374.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167 °C(lit.) |
| Boiling point: | 251.61°C (rough estimate) |
| Density | 1.08 |
| refractive index | 1.4365 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | DECOMPOSES |
| Sensitive | Moisture Sensitive |
| Merck | 14,1796 |
| BRN | 83657 |
| InChI | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2/t4-,5+,6-,7+ |
| InChIKey | KNDQHSIWLOJIGP-UMRXKNAANA-N |
| SMILES | C1(=O)[C@]2([H])[C@@]([H])([C@@]3([H])C[C@]2([H])C=C3)C(=O)O1 |&1:2,4,6,9,r| |
| CAS DataBase Reference | 129-64-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Endo-5-norbornene-2,3-dicarboxylic anhydride(129-64-6) |
Description and Uses
Carbic Anhydride is an intermediate used to prepare Endo-2,3-Norbornanedicarboximide (N661225) which is used to prepare piperidinylbenzisoxazole antipsychotic drugs.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H334 |
| Precautionary statements | P261-P272-P280-P284-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 41-42/43 |
| Safety Statements | 22-24-26-37/39 |
| WGK Germany | 3 |
| RTECS | DT5600000 |
| F | 21 |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |







