A6150112
4-Nitrothioanisole , 97% , 701-57-5
Synonym(s):
Methyl-4-nitrophenyl sulfide
CAS NO.：701-57-5
Empirical Formula: C7H7NO2S
Molecular Weight: 169.2
MDL number: MFCD00010868
EINECS: 677-868-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100g | RMB520.00 | In Stock |
|
| 500g | RMB2064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-69 °C (lit.)
68-72 °C (lit.) |
| Boiling point: | 140 °C / 2mmHg |
| Density | 1.2391 |
| refractive index | 1.6401 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Sensitive | Stench |
| BRN | 1817928 |
| InChI | InChI=1S/C7H7NO2S/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 |
| InChIKey | NEZGPRYOJVPJKL-UHFFFAOYSA-N |
| SMILES | C1(SC)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 701-57-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 4-nitrophenyl sulphide(701-57-5) |
Description and Uses
4-Nitrothioanisole may be used to synthesize 4-nitrothioanisole sulfoxide and methyl 4-nitrophenyl sulfoxide.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H311-H332 |
| Precautionary statements | P261-P280h-P301+P310a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39-36/37 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Stench |
| HazardClass | IRRITANT, STENCH |
| HS Code | 29309090 |
