A6151012
3-Nitrobenzotrifluoride , 97% , 98-46-4
Synonym(s):
3-Nitro-α,α,α-trifluorotoluene
CAS NO.：98-46-4
Empirical Formula: C7H4F3NO2
Molecular Weight: 191.11
MDL number: MFCD00007260
EINECS: 202-670-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -5 °C |
| Boiling point: | 200-205 °C(lit.) |
| Density | 1.436 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Water Solubility | 0.4 g/L (20 ºC) |
| BRN | 2051362 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-2-1-3-6(4-5)11(12)13/h1-4H |
| InChIKey | WHNAMGUAXHGCHH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 98-46-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-nitro-3-(trifluoromethyl)-(98-46-4) |
| EPA Substance Registry System | 3-Nitrobenzotrifluoride (98-46-4) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H330-H335 |
| Precautionary statements | P260-P264-P301+P312-P302+P352-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+,T,Xi |
| Risk Statements | 22-26-36/37/38-52/53-21/22 |
| Safety Statements | 26-28-36/37-45-61-36/37/39-28A |
| RIDADR | UN 2306 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | XT3500000 |
| Hazard Note | Highly Toxic/Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Hazardous Substances Data | 98-46-4(Hazardous Substances Data) |
