A6151612
N,N-Dimethylformamide-d<sub>7</sub> , D,99.5% , 4472-41-7
Synonym(s):
Dimethylformamide-D7;DMF-d7;Heptadeutero-N,N-dimethylformamide;Heptadeuterodimethylformamide
CAS NO.:4472-41-7
Empirical Formula: C3H7NO
Molecular Weight: 73.1
MDL number: MFCD00003286
EINECS: 224-745-8
| Pack Size | Price | Stock | Quantity |
| 0.6ml | RMB263.20 | In Stock |
|
| 1G | RMB387.20 | In Stock |
|
| 5G | RMB1895.20 | In Stock |
|
| 5×1g | RMB1999.20 | In Stock |
|
| 10ml | RMB3759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -61°C |
| Melting point: | -61°C |
| Boiling point: | 153°C |
| Boiling point: | 153 °C(lit.) |
| Density | 1.03 g/mL at 25 °C(lit.) |
| Density | d = 1,03 |
| vapor pressure | 3.77 hPa (20 °C) |
| refractive index | n |
| Flash point: | 136 °F |
| storage temp. | no restrictions. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless |
| explosive limit | 2.2-16%(V) |
| Water Solubility | Soluble in water. |
| BRN | 1908468 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| InChI | 1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3,3D |
| InChIKey | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| SMILES | [2H]C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 4472-41-7(CAS DataBase Reference) |
Description and Uses
N,N-Dimethylformamide-d7 may be used to study its metabolism in rats by 2H NMR spectroscopy.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H312+H332-H319-H360D |
| Precautionary statements | P210-P280-P303+P361+P353-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 61-20/21-36 |
| Safety Statements | 53-45-36/37-26 |
| RIDADR | UN 2265 3/PG 3 |
| WGK Germany | 2 |
| Autoignition Temperature | 440 °C |
| HS Code | 2845 90 10 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Liq. 3 Repr. 1B |
| Toxicity | LD50 orally in Rabbit: 2800 mg/kg LD50 dermal Rabbit 1500 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






