A6155012
Naphthol Green B , ≥80%(HPLC) , 19381-50-1
Synonym(s):
Acid Green 1;Green acid 1;Naphthol green B (C.I. 10020)
CAS NO.:19381-50-1
Empirical Formula: C30H15FeN3NaO15S3(-2)
Molecular Weight: 832.47
MDL number: MFCD00003886
EINECS: 243-010-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25G | RMB48.00 | In Stock |
|
| 100G | RMB125.60 | In Stock |
|
| 500G | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| bulk density | 620kg/m3 |
| storage temp. | room temp |
| solubility | 160g/l |
| form | Crystalline Powder |
| Colour Index | 10020 |
| color | Dark green |
| PH | 9.3 (10g/l, H2O, 20℃) |
| Water Solubility | 30 mg/mL |
| λmax | 714 nm |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | InChI=1S/3C10H7NO5S.Fe.Na/c3*12-9-4-1-6-5-7(17(14,15)16)2-3-8(6)10(9)11-13;;/h3*1-5,13H,(H,14,15,16);;/q;;;+3;+1/p-6/b3*11-10+;; |
| InChIKey | METAOVMACXXRHN-YKUQEDRPSA-H |
| SMILES | [O-]N1=C2C3C=CC(S([O-])(=O)=O)=CC=3C=CC2=O[Fe+3]231(O=C1C=CC4C=C(S([O-])(=O)=O)C=CC=4C1=N2[O-])O=C1C=CC2C=C(S([O-])(=O)=O)C=CC=2C1=N3[O-].[Na+] |
| LogP | 0.677 (est) |
| EPA Substance Registry System | C.I. Acid Green 1 (19381-50-1) |
Description and Uses
Naphthol Green B (CAS# 19381-50-1) is an organometallic dye which persists in wastewater as a pollutant. Various methods for the removal of Naphthol Green B, including hydrogen peroxide treatments, and the more complex use of magnetic halloysite-iron oxide nanocomposite. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H412 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P273-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LJ8930000 |
| TSCA | Yes |
| HS Code | 32041900 |





