A6159612
Nickel acetylacetonate , 95% , 3264-82-2
Synonym(s):
2,4-Pentanedione nickel(II) derivative;Bis(acetylacetonato)nickel(II), Bis(2,4-pentanedionato) nickel(II);Ni(acac)2;Nickel(II) acetylacetonate
CAS NO.:3264-82-2
Empirical Formula: C10H14NiO4
Molecular Weight: 256.91
MDL number: MFCD00000024
EINECS: 221-875-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB123.20 | In Stock |
|
| 250g | RMB199.20 | In Stock |
|
| 500G | RMB375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C (dec.)(lit.) |
| Boiling point: | 220 °C (11 mmHg) |
| Density | 0,145 g/cm3 |
| vapor pressure | 2.7 hPa (110 °C) |
| refractive index | 1.57-1.64 |
| Flash point: | >200°C |
| storage temp. | Store below +30°C. |
| solubility | 4.8g/l |
| form | Liquid |
| color | Clear pale yellow |
| Specific Gravity | 1.455 |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| Merck | 14,6500 |
| BRN | 4157970 |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| Stability: | hygroscopic |
| InChI | 1S/2C5H8O2.Ni/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | YAGMVFMEBGIOTO-FGSKAQBVSA-M |
| SMILES | CC(=O)\C=C(\C)O[Ni]O\C(C)=C/C(C)=O |
| LogP | 0.4 at 20℃ |
| CAS DataBase Reference | 3264-82-2 |
| NIST Chemistry Reference | Nickel acetylacetonate(3264-82-2) |
| EPA Substance Registry System | Nickel, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SP-4-1)- (3264-82-2) |
Description and Uses
Nickel Acetylacetonate is used in preparation method of Bisphenol Dipropargyl Ether and Cyanate Ester blending resin.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312-H317-H334-H341-H350 |
| Precautionary statements | P201-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 49-22-43-40 |
| Safety Statements | 53-36/37/39-45-36/37 |
| WGK Germany | 3 |
| RTECS | SA2100000 |
| TSCA | TSCA listed |
| HS Code | 29420000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Carc. 1A Muta. 2 Resp. Sens. 1 Skin Sens. 1 |
| Toxicity | LD50 orally in Rabbit: 587 mg/kg |






