A6165212
2-Nitrobenzenesulfonamide , 98% , 5455-59-4
Synonym(s):
NSC 23381;NSC 629275
| Pack Size | Price | Stock | Quantity |
| 5G | RMB366.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-192 °C (lit.) |
| Boiling point: | 418.8±47.0 °C(Predicted) |
| Density | 1.505 (estimate) |
| refractive index | 1.6490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly, Heated, Sonicated) |
| pka | 9.24±0.60(Predicted) |
| form | solid |
| color | Off-White to Brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 2214215 |
| InChI | InChI=1S/C6H6N2O4S/c7-13(11,12)6-4-2-1-3-5(6)8(9)10/h1-4H,(H2,7,11,12) |
| InChIKey | GNDKYAWHEKZHPJ-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 5455-59-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Nitrobenzenesulfonamide(5455-59-4) |
Description and Uses
2-Nitro-benzenesulfonamide is a carbonic anhydrase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





