A6172212
Nicotinic hydrazide , 98% , 553-53-7
Synonym(s):
Nicotinic acid hydrazide
CAS NO.:553-53-7
Empirical Formula: C6H7N3O
Molecular Weight: 137.14
MDL number: MFCD00006383
EINECS: 209-041-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB228.80 | In Stock |
|
| 500G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C(lit.) |
| Boiling point: | 251.97°C (rough estimate) |
| Density | 1.2620 (rough estimate) |
| refractive index | 1.6910 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | H2O: soluble50mg/mL |
| pka | 11.43±0.10(Predicted) |
| form | Fine Needle-Like Crystalline Powder |
| color | White to off-white |
| Water Solubility | Soluble in alcohol, water. |
| BRN | 119299 |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-2-1-3-8-4-5/h1-4H,7H2,(H,9,10) |
| InChIKey | KFUSANSHCADHNJ-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(NN)=O |
| CAS DataBase Reference | 553-53-7(CAS DataBase Reference) |
Description and Uses
Nicotinic hydrazide was used in hydrazone library formation. It was used to study the oxidation of isonicotinic acid hydrazide (isoniazid) by horseradish peroxidase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | QT1750000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
| Toxicity | LD50 intravenous in mouse: 180mg/kg |






