A6173312
6-Nitroindazole , 98% , 7597-18-4
CAS NO.:7597-18-4
Empirical Formula: C7H5N3O2
Molecular Weight: 163.13
MDL number: MFCD00005695
EINECS: 231-500-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB356.00 | In Stock |
|
| 250g | RMB775.20 | In Stock |
|
| 500G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 °C (lit.) |
| Boiling point: | 290.19°C (rough estimate) |
| Density | 1.4141 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in hot Methanol |
| form | Powder |
| pka | 11.08±0.40(Predicted) |
| color | Light Yellow |
| BRN | 7812 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)6-2-1-5-4-8-9-7(5)3-6/h1-4H,(H,8,9) |
| InChIKey | ORZRMRUXSPNQQL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC([N+]([O-])=O)=C2)C=N1 |
| CAS DataBase Reference | 7597-18-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Nitroindazole(7597-18-4) |
| EPA Substance Registry System | 1H-Indazole, 6-nitro- (7597-18-4) |
Description and Uses
6-Nitroindazole is a competitive and reversible Monoamine oxidase(MAO)inhibitor. It can inhibit MAO-A and MAO-B (IC50= 2.5 μM). Monoamine oxidase (MAO) B is a mitochondrial enzyme selectively involved in the oxidative activation of 1-methyl-4- phenyl-1,2,3,6-tetrahydropyridine (MPTP) neurotoxin to toxic pyridinium cations producing Parkinsonism in animal models. In addition, it is an nNOS inhibitor, which has neuroprotective effects[1].
Anticonvulsant.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-40-68-36 |
| Safety Statements | 26-27-36/37/39 |
| WGK Germany | 3 |
| RTECS | NK7962100 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |








