A6175112
4-Nitrophenyl acetate , 98% , 830-03-5
Synonym(s):
Acetic acid 4-nitrophenyl ester
CAS NO.:830-03-5
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007326
EINECS: 212-593-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB164.00 | In Stock |
|
| 100G | RMB523.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| vapor pressure | 1.28Pa at 20℃ |
| refractive index | 1.5468 (estimate) |
| storage temp. | -20°C |
| solubility | 0.53g/l |
| form | Powder |
| color | Green |
| Water Solubility | Insoluble in water. |
| BRN | 515874 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| InChIKey | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)OC(=O)C |
| LogP | 1.58 at 25℃ and pH6.83 |
| CAS DataBase Reference | 830-03-5(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, 4-nitrophenyl ester (830-03-5) |
Description and Uses
4-Nitrophenyl Acetate have been used as a substrate to study for the enzymatic activity of Carbonic Anhydrase III isolated from bovine skeletal muscle.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS03,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H317-H318 |
| Precautionary statements | P210-P220-P261-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | AJ1150000 |
| TSCA | TSCA listed |
| HS Code | 29153900 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Dam. 1 Ox. Sol. 3 Skin Sens. 1 |
| Toxicity | LD50 ivn-mus: 180 mg/kg CSLNX* NX#00217 |





![Bis(2,4-dinitrophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds by HPLC and FIA]](https://img.chemicalbook.com/CAS/GIF/16536-30-4.gif)


