A6176212
4-Nitrophenylacetic acid , 98% , 104-03-0
CAS NO.:104-03-0
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007383
EINECS: 203-168-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB36.80 | In Stock |
|
| 100G | RMB115.20 | In Stock |
|
| 250g | RMB207.20 | In Stock |
|
| 500G | RMB432.00 | In Stock |
|
| 2.5kg | RMB2036.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155 °C(lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 3.85(at 25℃) |
| color | Beige to yellow |
| PH | 2.98 at 22.8℃ and 10g/L |
| Water Solubility | slightly soluble |
| Merck | 14,6621 |
| BRN | 1911801 |
| InChI | 1S/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11) |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(cc1)[N+]([O-])=O |
| LogP | 0.3 at 30℃ and pH7.72 |
| CAS DataBase Reference | 104-03-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Nitrophenylacetic acid (104-03-0) |
Description and Uses
(4-Nitrophenyl)acetic Acid used in the synthesis of 5,7-dimethyl-2-aryl-3H-pyrrolizin-3-ones which may act as angiogenesis inhibitors. Also used in the one step construction of amino-substituted squaraine dye.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | AJ1130010 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| Toxicity | dnr-bcs 500 mg/disc MUREAV170,11,86 |







