A6178012
N-Nitrosodiphenylamine , 98% , 86-30-6
Synonym(s):
N-Nitroso-N-phenylaniline;Diphenylnitrosamine;Diphenylnitrosoamine;N-Nitroso-N-phenylaniline
CAS NO.:86-30-6
Empirical Formula: C12H10N2O
Molecular Weight: 198.22
MDL number: MFCD00019920
EINECS: 201-663-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-66 °C |
| Boiling point: | 268°C |
| Density | 1.23 |
| vapor pressure | 0.1 at 25 °C (assigned by analogy, Mabey et al., 1982) |
| refractive index | 1.6330 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| pka | -5.83±0.50(Predicted) |
| form | Yellow to brown or orange
powder or flakes |
| color | Yellow to brown to orange power or flakes |
| Water Solubility | Insoluble |
| BRN | 909531 |
| Henry's Law Constant | 2.33 at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Stability: | Stability Combustible. Incompatible with oxidising agents. |
| InChI | 1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | UBUCNCOMADRQHX-UHFFFAOYSA-N |
| SMILES | O=NN(c1ccccc1)c2ccccc2 |
| LogP | 3.13 at 25℃ |
| CAS DataBase Reference | 86-30-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, N-nitroso-N-phenyl-(86-30-6) |
| IARC | 3 (Vol. 27, Sup 7) 1987 |
| EPA Substance Registry System | N-Nitrosodiphenylamine (86-30-6) |
Description and Uses
N-Nitrosodiphenylamine is the N-nitroso analogue of diphenylamine that was once used as a rubber additive but is no longer due to undesirable carcinogenic effects (1). N-Nitrosodiphenylamine may have potential carcinogenic activity and is currently classified as a probable carcinogen by EPA with genetic toxicity (2,3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS06,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H320-H341-H351-H371-H373-H411-H302-H319-H225-H301+H311+H331-H370-H301-H311-H331 |
| Precautionary statements | P305+P351+P338-P210-P260-P280-P301+P310-P311-P201-P202-P264-P270-P273-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P311-P391-P405-P501 |
| target organs | Urinary bladder |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 22-36/37-53-45-16-7 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | JJ9800000 |
| F | 4.10-9-23 |
| TSCA | TSCA listed |
| HS Code | 2921.44.0500 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 1 Carc. 2 Repr. 2 Skin Sens. 1A STOT RE 2 |
| Hazardous Substances Data | 86-30-6(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for mice 3,850 mg/kg, rats 1,650 mg/kg (quoted, RTECS, 1985). |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







