A6178612
N-(1-naphthyl) ethylenediamine dihydrochloride , ACS,>98% , 1465-25-4
Synonym(s):
2-(1-Naphthylamino)ethylamine dihydrochloride;N-(1-Naphthyl)ethylenediamine dihydrochloride;Naphthylethylenediamine dihydrochloride
CAS NO.:1465-25-4
Empirical Formula: C12H16Cl2N2
Molecular Weight: 259.17
MDL number: MFCD00012556
EINECS: 215-981-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| bulk density | 380kg/m3 |
| storage temp. | Store at RT. |
| form | Powder |
| color | White to beige or pink |
| PH | 1.0 (25g/l, H2O, 20℃) |
| Water Solubility | soluble |
| Sensitive | Light Sensitive & Hygroscopic |
| Merck | 14,6409 |
| BRN | 3707471 |
| Stability: | Air Sensitive, Hygroscopic |
| InChI | InChI=1S/C12H14N2.2ClH/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;;/h1-7,14H,8-9,13H2;2*1H |
| InChIKey | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=CC=CC=2NCCN.Cl.Cl |
| CAS DataBase Reference | 1465-25-4(CAS DataBase Reference) |
| EPA Substance Registry System | N-(1-Naphthyl)ethylenediamine dihydrochloride (1465-25-4) |
Description and Uses
Usually used as a coupling agent for spectrophotometric analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | T,Xn,Xi |
| Risk Statements | 36/37/38-22-39/23/24/25-20/21/22 |
| Safety Statements | 36/37-45-37/39-26-36 |
| WGK Germany | 3 |
| RTECS | KV5330000 |
| F | 3-8-9-23 |
| TSCA | TSCA listed |
| HS Code | 29215990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 1465-25-4(Hazardous Substances Data) |





