NADP, Disodium Salt , 97% , 24292-60-2
Synonym(s):
β-NADH phosphate disodium salt;β-NADP-Na2;β-Nicotinamide-adenine Dinucleotide Phosphate, TPN, 2Na;NADP disodium salt;Nicotinamide adenine dinucleotide phosphate disodium salt
CAS NO.:24292-60-2
Empirical Formula: C21H26N7Na2O17P3
Molecular Weight: 787.37
MDL number: MFCD00065390
EINECS: 246-129-8
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB31.20 | In Stock |
|
| 100mg | RMB62.40 | In Stock |
|
| 250MG | RMB92.00 | In Stock |
|
| 1G | RMB158.40 | In Stock |
|
| 5g | RMB559.20 | In Stock |
|
| 25g | RMB1956.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 175-178 °C |
| Density | 1.66g/cm3 at 20℃ |
| vapor pressure | 0.002-0.004Pa at 20-25℃ |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Powder |
| color | Yellow |
| Odor | Odorless |
| PH | 4.0 ± 1.0(10mg/mL) |
| Water Solubility | >50 g/L |
| λmax | 260 nm |
| Stability: | Hygroscopic |
| InChIKey | UNRRSQIQTVFDLS-WUEGHLCSSA-L |
| SMILES | [Na+].[Na+].NC(=O)c1ccc[n+](c1)C2O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]3O[C@H]([C@H](OP(O)([O-])=O)[C@@H]3O)n4cnc5c(N)ncnc45)[C@@H](O)[C@H]2O |
| LogP | -4.4 at 20℃ and pH7 |
| Surface tension | 73.2mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 24292-60-2 |
Description and Uses
NADP+ is a coenzyme that is widely distributed in living matter, Participates in oxidation-reduction reactions. It serves as an electron carrier in a number of reactions, being alternately oxidized (NADP+) and reduced (NADPH).
NADP is a substance in which nicotinic acid amide adenine dinucleotide and a phosphate molecule are bound by ester bond. It is a hydrogen receptor and can be used for the development and development of a variety of in vitro diagnostic reagents. Prepared in large quantities.
Nicotinamide adenine dinucleotide phosphate (NADP) and NADPH form a redox pair. NADP/NADPH is a coenzyme that supports redox reactions via the transport of electrons in a vast array of applications, especially anaerobic reactions such as lipid and nucleic acid synthesis. NADP/NADPH is a coenzyme couple in various cytochrome P450 systems and oxidase/reductase reaction systems, such as the thioredoxin reductase/thioredoxin system.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-36-26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |




