A6180612
1,2-Naphthoquinone , 95% , 524-42-5
Synonym(s):
β-Naphthoquinone
CAS NO.:524-42-5
Empirical Formula: C10H6O2
Molecular Weight: 158.15
MDL number: MFCD00001698
EINECS: 208-360-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB116.80 | In Stock |
|
| 1G | RMB263.20 | In Stock |
|
| 5G | RMB791.20 | In Stock |
|
| 25G | RMB3167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-142 °C (dec.) (lit.) |
| Boiling point: | 243.22°C (rough estimate) |
| Density | 1.450 g/cm3 (25℃) |
| refractive index | 1.5300 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Crystalline Mass or Waxy Solid |
| color | Colorless or white to pale yellow |
| Merck | 14,6394 |
| BRN | 606546 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| InChIKey | KETQAJRQOHHATG-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C=CC1=O |
| CAS DataBase Reference | 524-42-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Naphthoquinone (524-42-5) |
Description and Uses
1,2-Naphthoquinone was employed as mediator during electrochemical mapping of redox activity in normal human breast (MCF-10A) cells by scanning electrochemical microscopy (SECM).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 22-36/37/38-34-11-25 |
| Safety Statements | 26-36-45-36/37/39-16-37/39-28A |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | QL7000000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 524-42-5(Hazardous Substances Data) |







