A6182012
Nitrofurantoin , Analysis standard , 67-20-9
Synonym(s):
N-(5-Nitro-2-furfurylidene)-1-aminohydantoin;Furadoxyl;Nitrofurantoine
CAS NO.:67-20-9
Empirical Formula: C8H6N4O5
Molecular Weight: 238.16
MDL number: MFCD00003224
EINECS: 200-646-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268°C |
| Boiling point: | 380.75°C (rough estimate) |
| Density | 1.5824 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMF: soluble50mg/mL |
| pka | 7.2(at 25℃) |
| form | crystalline |
| color | yellow |
| Water Solubility | <0.01 g/100 mL at 19 ºC |
| Sensitive | Light Sensitive & Hygroscopic |
| λmax | 358nm(MeOH)(lit.) |
| Merck | 14,6599 |
| BRN | 893207 |
| BCS Class | 2 |
| Stability: | Stability Stable, but light-sensitive. Combustible. Incompatible with strong oxidizing agents, strong alkalies, strong acids. Decomposes upon contact with most metals other than stainless steel and aluminium. |
| InChI | 1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ |
| InChIKey | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| SMILES | [O-][N+](=O)c1ccc(\C=N\N2CC(=O)NC2=O)o1 |
| CAS DataBase Reference | 67-20-9(CAS DataBase Reference) |
| IARC | 3 (Vol. 50) 1990 |
| NIST Chemistry Reference | Hydantoin, n-(5-nitro-2-furfurylidene)-1-amino-(67-20-9) |
| EPA Substance Registry System | Nitrofurantoin (67-20-9) |
Description and Uses
counterirritant
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H317-H334 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-42/43 |
| Safety Statements | 22-36/37-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | MU2800000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Sens. 1 |
| Hazardous Substances Data | 67-20-9(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 604mg/kg |






