A6184512
Nitrilotri(methylphosphonic acid) , 50%inwater , 6419-19-8
Synonym(s):
[Bis(phosphonomethyl)amino]methylphosphonic acid;Aminotris(methylenephosphonic acid);ATMP;Nitrilotri(methylphosphonic acid) solution
CAS NO.：6419-19-8
Empirical Formula: C3H12NO9P3
Molecular Weight: 299.05
MDL number: MFCD00002138
EINECS: 229-146-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB29.60 | In Stock |
|
| 500G | RMB67.20 | In Stock |
|
| 1KG | RMB126.40 | In Stock |
|
| 5KG | RMB552.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~215 °C (dec.) |
| Boiling point: | 746.2±70.0 °C(Predicted) |
| Density | 1.3 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Water (Slightly, Heated) |
| form | Solid |
| pka | 0.56±0.10(Predicted) |
| color | White |
| PH | 0.46 |
| Water Solubility | 500g/L at 20℃ |
| BRN | 1715724 |
| Stability: | Stable. Incompatible with bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | 1S/C3H12NO9P3/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | YDONNITUKPKTIG-UHFFFAOYSA-N |
| SMILES | OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O |
| LogP | -3.5 |
| CAS DataBase Reference | 6419-19-8(CAS DataBase Reference) |
| EPA Substance Registry System | Aminotri(methylene phosphonic acid) (6419-19-8) |
Description and Uses
Nitrilotri(methylphosphonic acid) is a common chelating agent used in synthetic chemistry. Some of the other applications include:
- Preparation of hexagonal porous three-dimensional structures encapsulating a template, layered structures with intercalated templates or linear polymers.
- Synthesis of metal-organic frameworks in combination with uranyl nitrate.
- Preparation of ingredient of anticorrosive protective coatings on the steel surface.
- ATMP can also be employed as a scale inhibitor during squeeze treatments in oilfield operations.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H290 |
| Precautionary statements | P234-P390 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36-34-35 |
| Safety Statements | 26-45-36/37/39-25-44-36 |
| RIDADR | 3265 |
| WGK Germany | 1 |
| RTECS | SZ9860000 |
| F | 3-9 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Met. Corr. 1 |
